C7H12N4O3 — CID 3591302
2-[(1,5-dimethyl-4-nitropyrazol-3-yl)amino]ethanol (PubChem CID 3591302) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-[(1,5-dimethyl-4-nitropyrazol-3-yl)amino]ethanol.
| Compound Name | 2-[(1,5-dimethyl-4-nitropyrazol-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 3591302 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-[(1,5-dimethyl-4-nitropyrazol-3-yl)amino]ethanol |
| SMILES | Cc1c([N+](=O)[O-])c(NCCO)nn1C |
| InChI | InChI=1S/C7H12N4O3/c1-5-6(11(13)14)7(8-3-4-12)9-10(5)2/h12H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | UQNIGAUTLLNWIH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|