C9H14N4O2 — CID 2805422
2-(1,5-dimethyl-4-nitropyrazol-3-yl)-N,N-dimethylethenamine (PubChem CID 2805422) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-(1,5-dimethyl-4-nitropyrazol-3-yl)-N,N-dimethylethenamine.
| Compound Name | 2-(1,5-dimethyl-4-nitropyrazol-3-yl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 2805422 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-(1,5-dimethyl-4-nitropyrazol-3-yl)-N,N-dimethylethenamine |
| SMILES | Cc1c([N+](=O)[O-])c(C=CN(C)C)nn1C |
| InChI | InChI=1S/C9H14N4O2/c1-7-9(13(14)15)8(10-12(7)4)5-6-11(2)3/h5-6H,1-4H3 |
| InChIKey | BGIAMSDXBXSVOK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|