C10H18N4O2 — CID 133276802
N,1,3-trimethyl-N-(2-methylpropyl)-4-nitropyrazol-5-amine (PubChem CID 133276802) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N,1,3-trimethyl-N-(2-methylpropyl)-4-nitropyrazol-5-amine.
| Compound Name | N,1,3-trimethyl-N-(2-methylpropyl)-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133276802 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N,1,3-trimethyl-N-(2-methylpropyl)-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)CC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N4O2/c1-7(2)6-12(4)10-9(14(15)16)8(3)11-13(10)5/h7H,6H2,1-5H3 |
| InChIKey | PXIQAOZLIJDQEN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|