C12H14ClN5O2 — CID 154784255
N-[(4-chloro-2-pyridinyl)methyl]-N,1,3-trimethyl-4-nitropyrazol-5-amine (PubChem CID 154784255) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is N-[(4-chloro-2-pyridinyl)methyl]-N,1,3-trimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[(4-chloro-2-pyridinyl)methyl]-N,1,3-trimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 154784255 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(4-chloro-2-pyridinyl)methyl]-N,1,3-trimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)Cc2cc(Cl)ccn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN5O2/c1-8-11(18(19)20)12(17(3)15-8)16(2)7-10-6-9(13)4-5-14-10/h4-6H,7H2,1-3H3 |
| InChIKey | ZXVXKJXYMXLJHU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|