C14H17BrN4O2 — CID 133424102
N-[(4-bromophenyl)methyl]-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine (PubChem CID 133424102) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[(4-bromophenyl)methyl]-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133424102 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-3-ethyl-N,1-dimethyl-4-nitropyrazol-5-amine |
| SMILES | CCc1nn(C)c(N(C)Cc2ccc(Br)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN4O2/c1-4-12-13(19(20)21)14(18(3)16-12)17(2)9-10-5-7-11(15)8-6-10/h5-8H,4,9H2,1-3H3 |
| InChIKey | QZEIVYXKMPIDKA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|