C12H13N5O2 — CID 91222541
benzyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene (PubChem CID 91222541) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is benzyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene.
| Compound Name | benzyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene |
|---|---|
| PubChem CID | 91222541 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | benzyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene |
| SMILES | Cc1nn(C)c(/N=N/Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O2/c1-9-11(17(18)19)12(16(2)15-9)14-13-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/b14-13+ |
| InChIKey | IVFJLANMIJJRIR-BUHFOSPRSA-N |
| XLogP | 2.92 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|