C16H16ClN7O4 — CID 134090774
N-(4-chlorophenyl)-N-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 134090774) has the molecular formula C16H16ClN7O4 and a molecular weight of 405.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-(4-chlorophenyl)-N-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 134090774 |
| Molecular Formula | C16H16ClN7O4 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(4-chlorophenyl)-N-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(c2ccc(Cl)cc2)c2c([N+](=O)[O-])c(C)nn2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClN7O4/c1-9-13(23(25)26)15(20(3)18-9)22(12-7-5-11(17)6-8-12)16-14(24(27)28)10(2)19-21(16)4/h5-8H,1-4H3 |
| InChIKey | AKLBRGIAQJKCGG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 125.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|