C12H12ClN5O2 — CID 90913966
(4-chlorophenyl)methyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene (PubChem CID 90913966) has the molecular formula C12H12ClN5O2 and a molecular weight of 293.71 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene.
| Compound Name | (4-chlorophenyl)methyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene |
|---|---|
| PubChem CID | 90913966 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (4-chlorophenyl)methyl-(1,3-dimethyl-4-nitropyrazol-5-yl)diazene |
| SMILES | Cc1nn(C)c(/N=N/Cc2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN5O2/c1-8-11(18(19)20)12(17(2)16-8)15-14-7-9-3-5-10(13)6-4-9/h3-6H,7H2,1-2H3/b15-14+ |
| InChIKey | PNGZWQKDYFCGDD-CCEZHUSRSA-N |
| XLogP | 3.57 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|