C15H17ClN4O5S — CID 19590093
N-[(4-chlorophenyl)methyl]-2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfonyl]acetamide (PubChem CID 19590093) has the molecular formula C15H17ClN4O5S and a molecular weight of 400.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfonyl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 19590093 |
| Molecular Formula | C15H17ClN4O5S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfonyl]acetamide |
| SMILES | Cc1nn(CS(=O)(=O)CC(=O)NCc2ccc(Cl)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17ClN4O5S/c1-10-15(20(22)23)11(2)19(18-10)9-26(24,25)8-14(21)17-7-12-3-5-13(16)6-4-12/h3-6H,7-9H2,1-2H3,(H,17,21) |
| InChIKey | IGASGAAYWGZIKL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|