C13H14Cl2N4O3 — CID 95620512
(1S)-1-(2,4-dichlorophenyl)-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethanol (PubChem CID 95620512) has the molecular formula C13H14Cl2N4O3 and a molecular weight of 345.19 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethanol.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 95620512 |
| Molecular Formula | C13H14Cl2N4O3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethanol |
| SMILES | Cc1nn(C)c(NC[C@@H](O)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14Cl2N4O3/c1-7-12(19(21)22)13(18(2)17-7)16-6-11(20)9-4-3-8(14)5-10(9)15/h3-5,11,16,20H,6H2,1-2H3/t11-/m1/s1 |
| InChIKey | SJFFEWGZPOPQME-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|