C12H12ClN7O2 — CID 126827692
N-[(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 126827692) has the molecular formula C12H12ClN7O2 and a molecular weight of 321.73 g/mol. Its IUPAC name is N-[(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 126827692 |
| Molecular Formula | C12H12ClN7O2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCc2nnc3ccc(Cl)cn23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClN7O2/c1-7-11(20(21)22)12(18(2)17-7)14-5-10-16-15-9-4-3-8(13)6-19(9)10/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | HMLXKZHOKYIELV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|