C7H14ClN5O2 — CID 18769501
N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,2-diamine;hydrochloride (PubChem CID 18769501) has the molecular formula C7H14ClN5O2 and a molecular weight of 235.67 g/mol. Its IUPAC name is N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 18769501 |
| Molecular Formula | C7H14ClN5O2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N'-(1,3-dimethyl-4-nitropyrazol-5-yl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cc1nn(C)c(NCCN)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C7H13N5O2.ClH/c1-5-6(12(13)14)7(9-4-3-8)11(2)10-5;/h9H,3-4,8H2,1-2H3;1H |
| InChIKey | HJWRARZQOMBIKD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|