C10H18N4O4 — CID 47983891
N-[2-(2-methoxyethoxy)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 47983891) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 47983891 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | COCCOCCNc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C10H18N4O4/c1-8-9(14(15)16)10(13(2)12-8)11-4-5-18-7-6-17-3/h11H,4-7H2,1-3H3 |
| InChIKey | TVQSBBUQYREUDO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|