C11H21N5O3 — CID 83030491
N'-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 83030491) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N'-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 83030491 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N'-(1-ethyl-3-methyl-4-nitropyrazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1NCCNCCOC |
| InChI | InChI=1S/C11H21N5O3/c1-4-15-11(10(16(17)18)9(2)14-15)13-6-5-12-7-8-19-3/h12-13H,4-8H2,1-3H3 |
| InChIKey | MBNSTPBVGORCJK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|