C10H16N4O5 — CID 81078597
2-[(1-ethyl-3-methyl-4-nitropyrazol-5-yl)amino]-3-methoxypropanoic acid (PubChem CID 81078597) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-[(1-ethyl-3-methyl-4-nitropyrazol-5-yl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(1-ethyl-3-methyl-4-nitropyrazol-5-yl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81078597 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[(1-ethyl-3-methyl-4-nitropyrazol-5-yl)amino]-3-methoxypropanoic acid |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1NC(COC)C(=O)O |
| InChI | InChI=1S/C10H16N4O5/c1-4-13-9(8(14(17)18)6(2)12-13)11-7(5-19-3)10(15)16/h7,11H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | NXYADCXABPCVJN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|