C12H20N4O5 — CID 66012309
4-methoxy-2-[(3-methyl-4-nitro-1-propylpyrazol-5-yl)amino]butanoic acid (PubChem CID 66012309) has the molecular formula C12H20N4O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-methoxy-2-[(3-methyl-4-nitro-1-propylpyrazol-5-yl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(3-methyl-4-nitro-1-propylpyrazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 66012309 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-methoxy-2-[(3-methyl-4-nitro-1-propylpyrazol-5-yl)amino]butanoic acid |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NC(CCOC)C(=O)O |
| InChI | InChI=1S/C12H20N4O5/c1-4-6-15-11(10(16(19)20)8(2)14-15)13-9(12(17)18)5-7-21-3/h9,13H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | KAOZYIYPEANXAR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|