C8H14N4O3 — CID 43554268
3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propan-1-ol (PubChem CID 43554268) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propan-1-ol.
| Compound Name | 3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 43554268 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]propan-1-ol |
| SMILES | Cc1nn(C)c(NCCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N4O3/c1-6-7(12(14)15)8(11(2)10-6)9-4-3-5-13/h9,13H,3-5H2,1-2H3 |
| InChIKey | XRRSZSAKNPCABH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|