C14H15N5O3 — CID 71996081
4-[2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethoxy]benzonitrile (PubChem CID 71996081) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-[2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 71996081 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-[2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]ethoxy]benzonitrile |
| SMILES | Cc1nn(C)c(NCCOc2ccc(C#N)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O3/c1-10-13(19(20)21)14(18(2)17-10)16-7-8-22-12-5-3-11(9-15)4-6-12/h3-6,16H,7-8H2,1-2H3 |
| InChIKey | DWMCTEGHDASXHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|