C14H17FN4O4 — CID 94664973
(2R)-1-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3-(4-fluorophenoxy)propan-2-ol (PubChem CID 94664973) has the molecular formula C14H17FN4O4 and a molecular weight of 324.31 g/mol. Its IUPAC name is (2R)-1-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3-(4-fluorophenoxy)propan-2-ol.
| Compound Name | (2R)-1-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3-(4-fluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 94664973 |
| Molecular Formula | C14H17FN4O4 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2R)-1-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3-(4-fluorophenoxy)propan-2-ol |
| SMILES | Cc1nn(C)c(NC[C@@H](O)COc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17FN4O4/c1-9-13(19(21)22)14(18(2)17-9)16-7-11(20)8-23-12-5-3-10(15)4-6-12/h3-6,11,16,20H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | LFEJXMFHJWNLRO-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|