C11H18N4O4 — CID 82017057
5-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-4-methylpentanoic acid (PubChem CID 82017057) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-4-methylpentanoic acid.
| Compound Name | 5-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82017057 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 5-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-4-methylpentanoic acid |
| SMILES | Cc1nn(C)c(NCC(C)CCC(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O4/c1-7(4-5-9(16)17)6-12-11-10(15(18)19)8(2)13-14(11)3/h7,12H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | GYFVWKYUMZMALM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|