C10H17N7O2 — CID 12024955
N'-[3-(dimethylaminomethylideneamino)-1-methyl-4-nitropyrazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 12024955) has the molecular formula C10H17N7O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N'-[3-(dimethylaminomethylideneamino)-1-methyl-4-nitropyrazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[3-(dimethylaminomethylideneamino)-1-methyl-4-nitropyrazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12024955 |
| Molecular Formula | C10H17N7O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N'-[3-(dimethylaminomethylideneamino)-1-methyl-4-nitropyrazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nn(C)c(/N=C/N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N7O2/c1-14(2)6-11-9-8(17(18)19)10(16(5)13-9)12-7-15(3)4/h6-7H,1-5H3/b11-6+,12-7+ |
| InChIKey | UYYADEINUVLHJL-GNXRPPCSSA-N |
| XLogP | 0.77 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|