C11H10ClN3O4S — CID 98468395
4-(3,5-dimethyl-4-nitropyrazol-1-yl)benzenesulfonyl chloride (PubChem CID 98468395) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-nitropyrazol-1-yl)benzenesulfonyl chloride.
| Compound Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 98468395 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)benzenesulfonyl chloride |
| SMILES | Cc1nn(-c2ccc(S(=O)(=O)Cl)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClN3O4S/c1-7-11(15(16)17)8(2)14(13-7)9-3-5-10(6-4-9)20(12,18)19/h3-6H,1-2H3 |
| InChIKey | JOJQIJVHQZLCCQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|