C9H8ClN5O2 — CID 12562847
3-chloro-6-(3,5-dimethyl-4-nitropyrazol-1-yl)pyridazine (PubChem CID 12562847) has the molecular formula C9H8ClN5O2 and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethyl-4-nitropyrazol-1-yl)pyridazine.
| Compound Name | 3-chloro-6-(3,5-dimethyl-4-nitropyrazol-1-yl)pyridazine |
|---|---|
| PubChem CID | 12562847 |
| Molecular Formula | C9H8ClN5O2 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-chloro-6-(3,5-dimethyl-4-nitropyrazol-1-yl)pyridazine |
| SMILES | Cc1nn(-c2ccc(Cl)nn2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8ClN5O2/c1-5-9(15(16)17)6(2)14(13-5)8-4-3-7(10)11-12-8/h3-4H,1-2H3 |
| InChIKey | OUOOTLVDZIAQNB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|