5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid

C12H10BrN3O4 — CID 114896055

IUPAC5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid
SMILESCc1nn(-c2ccc(Br)cc2C(=O)O)c(C)c1[N+](=O)[O-]
InChIInChI=1S/C12H10BrN3O4/c1-6-11(16(19)20)7(2)15(14-6)10-4-3-8(13)5-9(10)12(17)18/h3-5H,1-2H3,(H,17,18)
InChIKeyOCQHCVCLWHDCBP-UHFFFAOYSA-N
MW340.13 g/mol
LogP2.86
Rot. Bonds3

About 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid

5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid (PubChem CID 114896055) has the molecular formula C12H10BrN3O4 and a molecular weight of 340.13 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid.

Molecular Properties

Compound Name5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid
PubChem CID114896055
Molecular FormulaC12H10BrN3O4
Molecular Weight340.13 g/mol
Exact Mass338.99
IUPAC Name5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid
SMILESCc1nn(-c2ccc(Br)cc2C(=O)O)c(C)c1[N+](=O)[O-]
InChIInChI=1S/C12H10BrN3O4/c1-6-11(16(19)20)7(2)15(14-6)10-4-3-8(13)5-9(10)12(17)18/h3-5H,1-2H3,(H,17,18)
InChIKeyOCQHCVCLWHDCBP-UHFFFAOYSA-N
XLogP2.86
TPSA98.26 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.13
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid?
The IUPAC name of 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid (CID 114896055) is 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid.
What is the SMILES notation for 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid?
The canonical SMILES for 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid is Cc1nn(-c2ccc(Br)cc2C(=O)O)c(C)c1[N+](=O)[O-].
What is the InChIKey of 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid?
The InChIKey is OCQHCVCLWHDCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3O4/c1-6-11(16(19)20)7(2)15(14-6)10-4-3-8(13)5-9(10)12(17)18/h3-5H,1-2H3,(H,17,18).
What are the key properties of 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid?
5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid has a molecular weight of 340.13 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3,5-dimethyl-4-nitropyrazol-1-yl)benzoic acid is sourced from PubChem (CID 114896055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).