C6H8N4O3 — CID 134262667
3,5-dimethyl-4-nitropyrazole-1-carboxamide (PubChem CID 134262667) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 3,5-dimethyl-4-nitropyrazole-1-carboxamide.
| Compound Name | 3,5-dimethyl-4-nitropyrazole-1-carboxamide |
|---|---|
| PubChem CID | 134262667 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3,5-dimethyl-4-nitropyrazole-1-carboxamide |
| SMILES | Cc1nn(C(N)=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N4O3/c1-3-5(10(12)13)4(2)9(8-3)6(7)11/h1-2H3,(H2,7,11) |
| InChIKey | OBVJLEPFYOVXEZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|