C6H10N6O5 — CID 86749010
3,5-dimethyl-4-nitropyrazole-1-carboximidamide;nitric acid (PubChem CID 86749010) has the molecular formula C6H10N6O5 and a molecular weight of 246.18 g/mol. Its IUPAC name is 3,5-dimethyl-4-nitropyrazole-1-carboximidamide;nitric acid.
| Compound Name | 3,5-dimethyl-4-nitropyrazole-1-carboximidamide;nitric acid |
|---|---|
| PubChem CID | 86749010 |
| Molecular Formula | C6H10N6O5 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3,5-dimethyl-4-nitropyrazole-1-carboximidamide;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)n1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C6H9N5O2.HNO3/c1-3-5(11(12)13)4(2)10(9-3)6(7)8;2-1(3)4/h1-2H3,(H3,7,8);(H,2,3,4) |
| InChIKey | IVGVFAMZCJKRCJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|