C13H15N5O2 — CID 19382696
3,5-dimethyl-4-[(4-nitrophenyl)methyl]pyrazole-1-carboximidamide (PubChem CID 19382696) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(4-nitrophenyl)methyl]pyrazole-1-carboximidamide.
| Compound Name | 3,5-dimethyl-4-[(4-nitrophenyl)methyl]pyrazole-1-carboximidamide |
|---|---|
| PubChem CID | 19382696 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3,5-dimethyl-4-[(4-nitrophenyl)methyl]pyrazole-1-carboximidamide |
| SMILES | [H]/N=C(\N)n1nc(C)c(Cc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C13H15N5O2/c1-8-12(9(2)17(16-8)13(14)15)7-10-3-5-11(6-4-10)18(19)20/h3-6H,7H2,1-2H3,(H3,14,15) |
| InChIKey | HRVIBSCMKAVIJI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|