C8H13N3O3 — CID 60878381
1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 60878381) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 60878381 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | Cc1nn(CC(C)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N3O3/c1-5(12)4-10-7(3)8(11(13)14)6(2)9-10/h5,12H,4H2,1-3H3 |
| InChIKey | MXLCHWXOHXVXAO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|