C9H14BrN3O2 — CID 64996121
1-(3-bromo-2-methylpropyl)-3,5-dimethyl-4-nitropyrazole (PubChem CID 64996121) has the molecular formula C9H14BrN3O2 and a molecular weight of 276.13 g/mol. Its IUPAC name is 1-(3-bromo-2-methylpropyl)-3,5-dimethyl-4-nitropyrazole.
| Compound Name | 1-(3-bromo-2-methylpropyl)-3,5-dimethyl-4-nitropyrazole |
|---|---|
| PubChem CID | 64996121 |
| Molecular Formula | C9H14BrN3O2 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(3-bromo-2-methylpropyl)-3,5-dimethyl-4-nitropyrazole |
| SMILES | Cc1nn(CC(C)CBr)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14BrN3O2/c1-6(4-10)5-12-8(3)9(13(14)15)7(2)11-12/h6H,4-5H2,1-3H3 |
| InChIKey | REATWROOBPZLDN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|