C16H18N6O7 — CID 19562274
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methyl-N-(4-methyl-3,5-dinitrophenyl)propanamide (PubChem CID 19562274) has the molecular formula C16H18N6O7 and a molecular weight of 406.36 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methyl-N-(4-methyl-3,5-dinitrophenyl)propanamide.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methyl-N-(4-methyl-3,5-dinitrophenyl)propanamide |
|---|---|
| PubChem CID | 19562274 |
| Molecular Formula | C16H18N6O7 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methyl-N-(4-methyl-3,5-dinitrophenyl)propanamide |
| SMILES | Cc1nn(CC(C)C(=O)Nc2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N6O7/c1-8(7-19-11(4)15(22(28)29)10(3)18-19)16(23)17-12-5-13(20(24)25)9(2)14(6-12)21(26)27/h5-6,8H,7H2,1-4H3,(H,17,23) |
| InChIKey | VXVBMMKEDSFQTP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|