C20H23N7O4 — CID 19562331
N-[4-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 19562331) has the molecular formula C20H23N7O4 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[4-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19562331 |
| Molecular Formula | C20H23N7O4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[4-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(CC(C)C(=O)Nc2ccc(NC(=O)c3ccn(C)n3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N7O4/c1-12(11-26-14(3)18(27(30)31)13(2)23-26)19(28)21-15-5-7-16(8-6-15)22-20(29)17-9-10-25(4)24-17/h5-10,12H,11H2,1-4H3,(H,21,28)(H,22,29) |
| InChIKey | YYIIPVVQXNYHPQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|