C16H22N6O5 — CID 19562329
ethyl 5-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 19562329) has the molecular formula C16H22N6O5 and a molecular weight of 378.39 g/mol. Its IUPAC name is ethyl 5-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19562329 |
| Molecular Formula | C16H22N6O5 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 5-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanoyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C(C)Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H22N6O5/c1-6-27-16(24)12-7-17-20(5)14(12)18-15(23)9(2)8-21-11(4)13(22(25)26)10(3)19-21/h7,9H,6,8H2,1-5H3,(H,18,23) |
| InChIKey | YRTNYTBNJCVFFI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|