C15H20N6O5 — CID 19553613
ethyl 1-methyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]pyrazole-4-carboxylate (PubChem CID 19553613) has the molecular formula C15H20N6O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is ethyl 1-methyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19553613 |
| Molecular Formula | C15H20N6O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl 1-methyl-5-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C(CC)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H20N6O5/c1-5-11(20-9(3)7-12(18-20)21(24)25)14(22)17-13-10(8-16-19(13)4)15(23)26-6-2/h7-8,11H,5-6H2,1-4H3,(H,17,22) |
| InChIKey | NDSJKJUELXUQJH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|