C22H23N5O6 — CID 19553492
N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide (PubChem CID 19553492) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide.
| Compound Name | N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 19553492 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cc(Oc2cc(C)cc(C)c2)cc([N+](=O)[O-])c1)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H23N5O6/c1-5-20(25-15(4)9-21(24-25)27(31)32)22(28)23-16-10-17(26(29)30)12-19(11-16)33-18-7-13(2)6-14(3)8-18/h6-12,20H,5H2,1-4H3,(H,23,28) |
| InChIKey | UPMGTHPXEFPSQD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|