C19H20N6O5 — CID 19541749
ethyl 5-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-1-phenylpyrazole-4-carboxylate (PubChem CID 19541749) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is ethyl 5-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19541749 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 5-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)CCn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H20N6O5/c1-3-30-19(27)15-12-20-24(14-7-5-4-6-8-14)18(15)21-17(26)9-10-23-13(2)11-16(22-23)25(28)29/h4-8,11-12H,3,9-10H2,1-2H3,(H,21,26) |
| InChIKey | XVPXUCQQRNXGMW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|