C17H16N6O5 — CID 19263890
ethyl 5-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]-1-phenylpyrazole-4-carboxylate (PubChem CID 19263890) has the molecular formula C17H16N6O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is ethyl 5-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19263890 |
| Molecular Formula | C17H16N6O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 5-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1nn(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N6O5/c1-3-28-17(25)12-9-18-22(11-7-5-4-6-8-11)15(12)19-16(24)14-13(23(26)27)10-21(2)20-14/h4-10H,3H2,1-2H3,(H,19,24) |
| InChIKey | GZZNSLVNZSGODF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|