C24H26N6O5 — CID 108738641
ethyl 5-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-1-phenylpyrazole-4-carboxylate (PubChem CID 108738641) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is ethyl 5-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108738641 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | ethyl 5-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1ccc(N2CCN(C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26N6O5/c1-3-35-24(32)19-16-25-29(18-7-5-4-6-8-18)22(19)26-23(31)17-9-10-20(21(15-17)30(33)34)28-13-11-27(2)12-14-28/h4-10,15-16H,3,11-14H2,1-2H3,(H,26,31) |
| InChIKey | LCOKDTCMJZUYNK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|