C22H31Cl2N7O5 — CID 68990213
ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate;dihydrochloride (PubChem CID 68990213) has the molecular formula C22H31Cl2N7O5 and a molecular weight of 544.44 g/mol. Its IUPAC name is ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate;dihydrochloride.
| Compound Name | ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 68990213 |
| Molecular Formula | C22H31Cl2N7O5 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)n1nc2c(c1NC(=O)c1ccc(N3CCN(C)CC3)c([N+](=O)[O-])c1)CNC2(C)C.Cl.Cl |
| InChI | InChI=1S/C22H29N7O5.2ClH/c1-5-34-21(31)28-19(15-13-23-22(2,3)18(15)25-28)24-20(30)14-6-7-16(17(12-14)29(32)33)27-10-8-26(4)9-11-27;;/h6-7,12,23H,5,8-11,13H2,1-4H3,(H,24,30);2*1H |
| InChIKey | DYJCPNWPGKHMRO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|