C24H21Cl2FN6O6 — CID 87319946
ethyl 5-[chloro-(2-chlorophenyl)carbamoyl]-3-[(4-fluoro-3-nitrobenzoyl)amino]-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate (PubChem CID 87319946) has the molecular formula C24H21Cl2FN6O6 and a molecular weight of 579.37 g/mol. Its IUPAC name is ethyl 5-[chloro-(2-chlorophenyl)carbamoyl]-3-[(4-fluoro-3-nitrobenzoyl)amino]-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate.
| Compound Name | ethyl 5-[chloro-(2-chlorophenyl)carbamoyl]-3-[(4-fluoro-3-nitrobenzoyl)amino]-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 87319946 |
| Molecular Formula | C24H21Cl2FN6O6 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | ethyl 5-[chloro-(2-chlorophenyl)carbamoyl]-3-[(4-fluoro-3-nitrobenzoyl)amino]-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazole-2-carboxylate |
| SMILES | CCOC(=O)n1nc2c(c1NC(=O)c1ccc(F)c([N+](=O)[O-])c1)CN(C(=O)N(Cl)c1ccccc1Cl)C2(C)C |
| InChI | InChI=1S/C24H21Cl2FN6O6/c1-4-39-23(36)32-20(28-21(34)13-9-10-16(27)18(11-13)33(37)38)14-12-30(24(2,3)19(14)29-32)22(35)31(26)17-8-6-5-7-15(17)25/h5-11H,4,12H2,1-3H3,(H,28,34) |
| InChIKey | YHXFYNBKRMOZFG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|