C17H18FN5O5 — CID 69039016
ethyl 3-[(4-fluoro-2-nitrobenzoyl)amino]-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate (PubChem CID 69039016) has the molecular formula C17H18FN5O5 and a molecular weight of 391.36 g/mol. Its IUPAC name is ethyl 3-[(4-fluoro-2-nitrobenzoyl)amino]-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate.
| Compound Name | ethyl 3-[(4-fluoro-2-nitrobenzoyl)amino]-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 69039016 |
| Molecular Formula | C17H18FN5O5 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | ethyl 3-[(4-fluoro-2-nitrobenzoyl)amino]-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazole-2-carboxylate |
| SMILES | CCOC(=O)n1nc2c(c1NC(=O)c1ccc(F)cc1[N+](=O)[O-])CNC2(C)C |
| InChI | InChI=1S/C17H18FN5O5/c1-4-28-16(25)22-14(11-8-19-17(2,3)13(11)21-22)20-15(24)10-6-5-9(18)7-12(10)23(26)27/h5-7,19H,4,8H2,1-3H3,(H,20,24) |
| InChIKey | SUYSRGORISMOSF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|