C27H37N7O7 — CID 68989603
5-O-tert-butyl 2-O-ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylate (PubChem CID 68989603) has the molecular formula C27H37N7O7 and a molecular weight of 571.64 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O-ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 2-O-ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 68989603 |
| Molecular Formula | C27H37N7O7 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 5-O-tert-butyl 2-O-ethyl 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylate |
| SMILES | CCOC(=O)n1nc2c(c1NC(=O)c1ccc(N3CCN(C)CC3)c([N+](=O)[O-])c1)CN(C(=O)OC(C)(C)C)C2(C)C |
| InChI | InChI=1S/C27H37N7O7/c1-8-40-25(37)33-22(18-16-32(24(36)41-26(2,3)4)27(5,6)21(18)29-33)28-23(35)17-9-10-19(20(15-17)34(38)39)31-13-11-30(7)12-14-31/h9-10,15H,8,11-14,16H2,1-7H3,(H,28,35) |
| InChIKey | LTNLDMMIQZMBGD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 152.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|