C22H27N5O7 — CID 121438506
5-O-tert-butyl 1-O-ethyl 6,6-dimethyl-3-[(3-nitrobenzoyl)amino]-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate (PubChem CID 121438506) has the molecular formula C22H27N5O7 and a molecular weight of 473.49 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl 6,6-dimethyl-3-[(3-nitrobenzoyl)amino]-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl 6,6-dimethyl-3-[(3-nitrobenzoyl)amino]-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 121438506 |
| Molecular Formula | C22H27N5O7 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl 6,6-dimethyl-3-[(3-nitrobenzoyl)amino]-4H-pyrrolo[3,4-d]pyrazole-1,5-dicarboxylate |
| SMILES | CCOC(=O)n1nc(NC(=O)c2cccc([N+](=O)[O-])c2)c2c1C(C)(C)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C22H27N5O7/c1-7-33-20(30)26-16-15(12-25(22(16,5)6)19(29)34-21(2,3)4)17(24-26)23-18(28)13-9-8-10-14(11-13)27(31)32/h8-11H,7,12H2,1-6H3,(H,23,24,28) |
| InChIKey | GMMFMSXZNUGQOQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|