C18H25N5O4 — CID 121443996
tert-butyl 4-amino-5,5-dimethyl-3-[N'-(3-nitrophenyl)carbamimidoyl]-2H-pyrrole-1-carboxylate (PubChem CID 121443996) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is tert-butyl 4-amino-5,5-dimethyl-3-[N'-(3-nitrophenyl)carbamimidoyl]-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-amino-5,5-dimethyl-3-[N'-(3-nitrophenyl)carbamimidoyl]-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 121443996 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl 4-amino-5,5-dimethyl-3-[N'-(3-nitrophenyl)carbamimidoyl]-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(/C(N)=N/c2cccc([N+](=O)[O-])c2)=C(N)C1(C)C |
| InChI | InChI=1S/C18H25N5O4/c1-17(2,3)27-16(24)22-10-13(14(19)18(22,4)5)15(20)21-11-7-6-8-12(9-11)23(25)26/h6-9H,10,19H2,1-5H3,(H2,20,21) |
| InChIKey | CXIKCPYXLVIEFA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|