C22H24N2O6 — CID 101004795
tert-butyl (2R)-6-methyl-6-(3-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinane-3-carboxylate (PubChem CID 101004795) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is tert-butyl (2R)-6-methyl-6-(3-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinane-3-carboxylate.
| Compound Name | tert-butyl (2R)-6-methyl-6-(3-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 101004795 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | tert-butyl (2R)-6-methyl-6-(3-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC(C)(c2cccc([N+](=O)[O-])c2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O6/c1-21(2,3)30-20(26)23-18(25)14-22(4,16-11-8-12-17(13-16)24(27)28)29-19(23)15-9-6-5-7-10-15/h5-13,19H,14H2,1-4H3/t19-,22?/m1/s1 |
| InChIKey | SJTSHXGPKDIJQM-LCQOSCCDSA-N |
| XLogP | 4.69 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|