C16H21NO3 — CID 86605055
tert-butyl 2-methyl-4-oxo-2-phenylpyrrolidine-1-carboxylate (PubChem CID 86605055) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl 2-methyl-4-oxo-2-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-4-oxo-2-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86605055 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | tert-butyl 2-methyl-4-oxo-2-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1(C)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-15(2,3)20-14(19)17-11-13(18)10-16(17,4)12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | FCQQMKFPOZVYCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |