C18H27NO2 — CID 135033621
tert-butyl 2-methyl-2-phenylazepane-1-carboxylate (PubChem CID 135033621) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-phenylazepane-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-2-phenylazepane-1-carboxylate |
|---|---|
| PubChem CID | 135033621 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | tert-butyl 2-methyl-2-phenylazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC1(C)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-17(2,3)21-16(20)19-14-10-6-9-13-18(19,4)15-11-7-5-8-12-15/h5,7-8,11-12H,6,9-10,13-14H2,1-4H3 |
| InChIKey | OIUIYBRSFMNCDV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |