C17H25NO2 — CID 102345334
tert-butyl (2R)-2-methyl-2-phenylpiperidine-1-carboxylate (PubChem CID 102345334) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102345334 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl (2R)-2-methyl-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-16(2,3)20-15(19)18-13-9-8-12-17(18,4)14-10-6-5-7-11-14/h5-7,10-11H,8-9,12-13H2,1-4H3/t17-/m1/s1 |
| InChIKey | WAVNRUNVRWHPKF-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |