C17H22F3NO2 — CID 135390683
tert-butyl 2,2-difluoro-3-(fluoromethyl)-3-phenylpiperidine-1-carboxylate (PubChem CID 135390683) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is tert-butyl 2,2-difluoro-3-(fluoromethyl)-3-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2,2-difluoro-3-(fluoromethyl)-3-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 135390683 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | tert-butyl 2,2-difluoro-3-(fluoromethyl)-3-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CF)(c2ccccc2)C1(F)F |
| InChI | InChI=1S/C17H22F3NO2/c1-15(2,3)23-14(22)21-11-7-10-16(12-18,17(21,19)20)13-8-5-4-6-9-13/h4-6,8-9H,7,10-12H2,1-3H3 |
| InChIKey | NIFJWVISFZGNPF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|