C20H29NO5 — CID 113345952
1-O-tert-butyl 2-O-methyl 2-(3-phenoxypropyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 113345952) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 2-(3-phenoxypropyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 2-(3-phenoxypropyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 113345952 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 2-(3-phenoxypropyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1(CCCOc2ccccc2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO5/c1-19(2,3)26-18(23)21-14-8-12-20(21,17(22)24-4)13-9-15-25-16-10-6-5-7-11-16/h5-7,10-11H,8-9,12-15H2,1-4H3 |
| InChIKey | QJJCUIVVXGDNEB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|