C17H31NO5 — CID 103886310
1-O-tert-butyl 2-O-methyl 2-(2-butoxyethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 103886310) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 2-(2-butoxyethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 2-(2-butoxyethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 103886310 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 2-(2-butoxyethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOCCC1(C(=O)OC)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO5/c1-6-7-12-22-13-10-17(14(19)21-5)9-8-11-18(17)15(20)23-16(2,3)4/h6-13H2,1-5H3 |
| InChIKey | DPHPEOYFWPDNGX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|